cas: 41177-72-4 — see every product listed under this CAS number, including other names
5-Bromo-2,3-dihydrobenzo[b]furan-7-carboxylic acid, 98% (CAS 41177-72-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F066344-1G |
| cas | 41177-72-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1034.03 Pln | |
| Fluorochem | 5g | 2986.47 Pln | |
| Fluorochem | 10g | 5256.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2,3-dihydro-1-benzofuran-7-carboxylic acid (CAS 41177-72-4) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 5-bromo-2,3-dihydro-1-benzofuran-7-carboxylic acid. InChIKey: LEBMKAXASFPSFA-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 5-bromo-2,3-dihydro-1-benzofuran-7-carboxylic acid |
| InChIKey | LEBMKAXASFPSFA-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2C(=O)O)Br |
Computed by PubChem (NCBI)