cas: 19725-82-7 — see every product listed under this CAS number, including other names
5-Bromo-2-(carboxymethyl)benzoic acid, 97% (CAS 19725-82-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F229568-250MG |
| cas | 19725-82-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 357.18 Pln | |
| Fluorochem | 1g | 810.15 Pln | |
| Fluorochem | 5g | 2663.66 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2-(carboxymethyl)benzoic acid (CAS 19725-82-7) is a chemical compound with the molecular formula C9H7BrO4 and a molecular weight of 259.05 g/mol. IUPAC name: 5-bromo-2-(carboxymethyl)benzoic acid. InChIKey: VFYONOBJKYTLNC-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO4 |
|---|---|
| Molecular weight | 259.05 g/mol |
| IUPAC name | 5-bromo-2-(carboxymethyl)benzoic acid |
| InChIKey | VFYONOBJKYTLNC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(=O)O)CC(=O)O |
Computed by PubChem (NCBI)