cas: 949014-42-0 — see every product listed under this CAS number, including other names
5-Bromo-2-fluoro-4-methoxybenzoic acid 96% (CAS 949014-42-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A394252-100mg |
| cas | 949014-42-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 359.25 Pln | |
| Ambeed | 250mg | 476.06 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 2167.06 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A394252 |
5-bromo-2-fluoro-4-methoxybenzoic acid (CAS 949014-42-0) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 5-bromo-2-fluoro-4-methoxybenzoic acid. InChIKey: DSLNYARFEZMGKA-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 5-bromo-2-fluoro-4-methoxybenzoic acid |
| InChIKey | DSLNYARFEZMGKA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)F)C(=O)O)Br |
Computed by PubChem (NCBI)