cas: 949014-42-0 — see every product listed under this CAS number, including other names
5-bromo-2-fluoro-4-methoxybenzoic acid, 96%, 96% (CAS 949014-42-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1178AW-100mg |
| cas | 949014-42-0 |
| size | 100mg |
| availability | 6.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 232.40 Pln | |
| Chemat | 250mg | 333.20 Pln | |
| Chemat | 1g | 626.00 Pln | |
| Chemat | 5g | 1758.80 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
5-bromo-2-fluoro-4-methoxybenzoic acid (CAS 949014-42-0) is a chemical compound with the molecular formula C8H6BrFO3 and a molecular weight of 249.03 g/mol. IUPAC name: 5-bromo-2-fluoro-4-methoxybenzoic acid. InChIKey: DSLNYARFEZMGKA-UHFFFAOYSA-N.
| Molecular formula | C8H6BrFO3 |
|---|---|
| Molecular weight | 249.03 g/mol |
| IUPAC name | 5-bromo-2-fluoro-4-methoxybenzoic acid |
| InChIKey | DSLNYARFEZMGKA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)F)C(=O)O)Br |
Computed by PubChem (NCBI)