cas: 95192-64-6 — see every product listed under this CAS number, including other names
5-Bromo-2-methyl-1,3-dinitrobenzene, 95% (CAS 95192-64-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F214613-1G |
| cas | 95192-64-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 10g | 529.00 Pln | |
| Fluorochem | 25g | 1237.08 Pln | |
| Fluorochem | 100g | 4793.12 Pln | |
| Fluorochem | 500g | 6870.52 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-bromo-2-methyl-1,3-dinitrobenzene (CAS 95192-64-6) is a chemical compound with the molecular formula C7H5BrN2O4 and a molecular weight of 261.03 g/mol. IUPAC name: 5-bromo-2-methyl-1,3-dinitrobenzene. InChIKey: UOGCLPDKGPPDHM-UHFFFAOYSA-N.
| Molecular formula | C7H5BrN2O4 |
|---|---|
| Molecular weight | 261.03 g/mol |
| IUPAC name | 5-bromo-2-methyl-1,3-dinitrobenzene |
| InChIKey | UOGCLPDKGPPDHM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1[N+](=O)[O-])Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)