CAS 2404734-01-4 appears in our catalog under these names: 5-Bromo-4-ethoxy-2,3-difluorobenzaldehyde, 95%, 5-Bromo-4-ethoxy-2,3-difluorobenzaldehyde, ≥95%, 5-Bromo-4-ethoxy-2,3-difluorobenzaldehyde, ≥95%, ≥95%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 5g, 25g, 10g, 1g, 250mg.
5-bromo-4-ethoxy-2,3-difluorobenzaldehyde (CAS 2404734-01-4) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: 5-bromo-4-ethoxy-2,3-difluorobenzaldehyde. InChIKey: SBWAKWGNBYMGCE-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | 5-bromo-4-ethoxy-2,3-difluorobenzaldehyde |
| InChIKey | SBWAKWGNBYMGCE-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C(=C1F)F)C=O)Br |
Computed by PubChem (NCBI)