CAS 1249746-86-8 is the registry number for 3-Bromo-2-(2,2-difluoroethoxy)benzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
3-bromo-2-(2,2-difluoroethoxy)benzaldehyde (CAS 1249746-86-8) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: 3-bromo-2-(2,2-difluoroethoxy)benzaldehyde. InChIKey: DWGKVWYFGQJOGW-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | 3-bromo-2-(2,2-difluoroethoxy)benzaldehyde |
| InChIKey | DWGKVWYFGQJOGW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)OCC(F)F)C=O |
Computed by PubChem (NCBI)