CAS 2484888-96-0 appears in our catalog under these names: 2-(3-Bromo-2,4-difluorophenyl)-1,3-dioxolane, 95%, 2-(3-Bromo-2,4-difluorophenyl)-1,3-dioxolane, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
2-(3-bromo-2,4-difluorophenyl)-1,3-dioxolane (CAS 2484888-96-0) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: 2-(3-bromo-2,4-difluorophenyl)-1,3-dioxolane. InChIKey: XEBPNSQKENLZRG-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | 2-(3-bromo-2,4-difluorophenyl)-1,3-dioxolane |
| InChIKey | XEBPNSQKENLZRG-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C(=C(C=C2)F)Br)F |
Computed by PubChem (NCBI)