CAS 2221812-19-5 appears in our catalog under these names: 2-(5-Bromo-2,3-difluorophenyl)-1,3-dioxolane, 95%, 2-(5-Bromo-2,3-difluorophenyl)-1,3-dioxolane, ≥95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 25g, 250mg, 1g.
2-(5-bromo-2,3-difluorophenyl)-1,3-dioxolane (CAS 2221812-19-5) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: 2-(5-bromo-2,3-difluorophenyl)-1,3-dioxolane. InChIKey: MMXDPXNJQQVIHZ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | 2-(5-bromo-2,3-difluorophenyl)-1,3-dioxolane |
| InChIKey | MMXDPXNJQQVIHZ-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C(=CC(=C2)Br)F)F |
Computed by PubChem (NCBI)