CAS 773087-43-7 appears in our catalog under these names: 2-(4-Bromo-2,6-difluorophenyl)-1,3-dioxolane, 96%, 2-(4-Bromo-2,6-difluorophenyl)-1,3-dioxolane, 98%, 2-(4-Bromo-2,6-difluorophenyl)-1,3-dioxolane. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 10g.
2-(4-bromo-2,6-difluorophenyl)-1,3-dioxolane (CAS 773087-43-7) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: 2-(4-bromo-2,6-difluorophenyl)-1,3-dioxolane. InChIKey: WTFMOVNMFQDXNI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | 2-(4-bromo-2,6-difluorophenyl)-1,3-dioxolane |
| InChIKey | WTFMOVNMFQDXNI-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=C(C=C2F)Br)F |
Computed by PubChem (NCBI)