CAS 1504876-00-9 appears in our catalog under these names: Ethyl 3-bromo-2,5-difluorobenzoate, 95%, Ethyl 3-bromo-2,5-difluorobenzoate, 97%, Ethyl 3-bromo-2,5-difluorobenzoate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
Ethyl 3-bromo-2,5-difluorobenzoate (CAS 1504876-00-9) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: ethyl 3-bromo-2,5-difluorobenzoate. InChIKey: LNANLRIATMKUKI-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | ethyl 3-bromo-2,5-difluorobenzoate |
| InChIKey | LNANLRIATMKUKI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC(=C1)F)Br)F |
Computed by PubChem (NCBI)