Products 1187386-10-2

CAS 1187386-10-2 is the registry number for Ethyl 5-bromo-2,3-difluorobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 5-bromo-2,3-difluorobenzoate (CAS 1187386-10-2) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: ethyl 5-bromo-2,3-difluorobenzoate. InChIKey: WGGFCFSFNZQGLL-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7BrF2O2
Molecular weight265.05 g/mol
IUPAC nameethyl 5-bromo-2,3-difluorobenzoate
InChIKeyWGGFCFSFNZQGLL-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C(=CC(=C1)Br)F)F

Computed by PubChem (NCBI)