CAS 1187386-10-2 is the registry number for Ethyl 5-bromo-2,3-difluorobenzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 5-bromo-2,3-difluorobenzoate (CAS 1187386-10-2) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: ethyl 5-bromo-2,3-difluorobenzoate. InChIKey: WGGFCFSFNZQGLL-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | ethyl 5-bromo-2,3-difluorobenzoate |
| InChIKey | WGGFCFSFNZQGLL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC(=C1)Br)F)F |
Computed by PubChem (NCBI)