Products 1807187-56-9
CAS 1807187-56-9 is the registry number for methyl 2-(2-bromo-4,5-difluorophenyl)acetate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g.
Methyl 2-(2-bromo-4,5-difluorophenyl)acetate (CAS 1807187-56-9) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: methyl 2-(2-bromo-4,5-difluorophenyl)acetate. InChIKey: GPEQUMVOTNLGKQ-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | methyl 2-(2-bromo-4,5-difluorophenyl)acetate |
| InChIKey | GPEQUMVOTNLGKQ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=C(C=C1Br)F)F |
Computed by PubChem (NCBI)