cas: 7748-58-5 — see every product listed under this CAS number, including other names
5-Bromo-6-nitro-1,3-benzodioxole, 99.53% (CAS 7748-58-5) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 100 mg, 250 mg, 500 mg, 1 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W153871-5 g |
| cas | 7748-58-5 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 2135.50 Pln | |
| MedChemExpress | 100 mg | 273.25 Pln | |
| MedChemExpress | 250 mg | 384.71 Pln | |
| MedChemExpress | 500 mg | 505.45 Pln | |
| MedChemExpress | 1 g | 695.86 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.53% |
5-bromo-6-nitro-1,3-benzodioxole (CAS 7748-58-5) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 5-bromo-6-nitro-1,3-benzodioxole. InChIKey: WXXFALFBNSJISM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 5-bromo-6-nitro-1,3-benzodioxole |
| InChIKey | WXXFALFBNSJISM-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)