cas: 7748-58-5 — see every product listed under this CAS number, including other names
5-Bromo-6-nitrobenzo[d][1,3]dioxole 98% (CAS 7748-58-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A181554-100mg |
| cas | 7748-58-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 236.88 Pln | |
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 592.88 Pln | |
| Ambeed | 5g | 1905.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A181554 |
5-bromo-6-nitro-1,3-benzodioxole (CAS 7748-58-5) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 5-bromo-6-nitro-1,3-benzodioxole. InChIKey: WXXFALFBNSJISM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 5-bromo-6-nitro-1,3-benzodioxole |
| InChIKey | WXXFALFBNSJISM-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)