cas: 98555-51-2 — see every product listed under this CAS number, including other names
5-Bromopyridine-2,3-dicarboxylic acid, 97% (CAS 98555-51-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F078436-1G |
| cas | 98555-51-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 112.48 Pln | |
| Fluorochem | 5g | 258.26 Pln | |
| Fluorochem | 10g | 456.11 Pln | |
| Fluorochem | 25g | 1039.24 Pln | |
| Fluorochem | 100g | 3887.19 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5-bromopyridine-2,3-dicarboxylic acid (CAS 98555-51-2) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 5-bromopyridine-2,3-dicarboxylic acid. InChIKey: WDDREAGLVSBXOG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 5-bromopyridine-2,3-dicarboxylic acid |
| InChIKey | WDDREAGLVSBXOG-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)C(=O)O)Br |
Computed by PubChem (NCBI)