cas: 98555-51-2 — see every product listed under this CAS number, including other names
5-Bromopyridine-2,3-dicarboxylic acid, 97%, 97% (CAS 98555-51-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IK5O-100mg |
| cas | 98555-51-2 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 184.40 Pln | |
| Chemat | 10g | 309.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-bromopyridine-2,3-dicarboxylic acid (CAS 98555-51-2) is a chemical compound with the molecular formula C7H4BrNO4 and a molecular weight of 246.01 g/mol. IUPAC name: 5-bromopyridine-2,3-dicarboxylic acid. InChIKey: WDDREAGLVSBXOG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrNO4 |
|---|---|
| Molecular weight | 246.01 g/mol |
| IUPAC name | 5-bromopyridine-2,3-dicarboxylic acid |
| InChIKey | WDDREAGLVSBXOG-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1C(=O)O)C(=O)O)Br |
Computed by PubChem (NCBI)