cas: 119584-75-7 — see every product listed under this CAS number, including other names
5-Bromoquinazoline-2,4-diamine, 95+% (CAS 119584-75-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A459526-5g |
| cas | 119584-75-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7263.55 Pln | |
| AmBeed | 100mg | 694.96 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-bromoquinazoline-2,4-diamine (CAS 119584-75-7) is a chemical compound with the molecular formula C8H7BrN4 and a molecular weight of 239.07 g/mol. IUPAC name: 5-bromoquinazoline-2,4-diamine. InChIKey: NPAVQJGHQXYNDS-UHFFFAOYSA-N.
| Molecular formula | C8H7BrN4 |
|---|---|
| Molecular weight | 239.07 g/mol |
| IUPAC name | 5-bromoquinazoline-2,4-diamine |
| InChIKey | NPAVQJGHQXYNDS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Br)C(=NC(=N2)N)N |
Computed by PubChem (NCBI)