cas: 1044770-70-8 — see every product listed under this CAS number, including other names
5-CHLORO-3-ISOPROPYL-2-METHYL-3H-IMIDAZO[4,5-B]PYRIDINE, 95% (CAS 1044770-70-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386270-100MG |
| cas | 1044770-70-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1939.96 Pln | |
| Fluorochem | 250mg | 3064.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-2-methyl-3-propan-2-ylimidazo[4,5-b]pyridine (CAS 1044770-70-8) is a chemical compound with the molecular formula C10H12ClN3 and a molecular weight of 209.67 g/mol. IUPAC name: 5-chloro-2-methyl-3-propan-2-ylimidazo[4,5-b]pyridine. InChIKey: QEUZYUFHFPLSQO-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 5-chloro-2-methyl-3-propan-2-ylimidazo[4,5-b]pyridine |
| InChIKey | QEUZYUFHFPLSQO-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C(C)C)N=C(C=C2)Cl |
Computed by PubChem (NCBI)