CAS 175531-38-1 is the registry number for (5-Phenyl-1h-imidazol-2-yl)methanamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(5-phenyl-1H-imidazol-2-yl)methanamine;hydrochloride (CAS 175531-38-1) is a chemical compound with the molecular formula C10H12ClN3 and a molecular weight of 209.67 g/mol. IUPAC name: (5-phenyl-1H-imidazol-2-yl)methanamine;hydrochloride. InChIKey: HPQQIZHQBBTZPR-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | (5-phenyl-1H-imidazol-2-yl)methanamine;hydrochloride |
| InChIKey | HPQQIZHQBBTZPR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CN=C(N2)CN.Cl |
Computed by PubChem (NCBI)