CAS 1177321-53-7 is the registry number for [2-(5-Chloro-1h-benzimidazol-2-yl)ethyl]methylamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
2-(6-chloro-1H-benzimidazol-2-yl)-N-methylethanamine (CAS 1177321-53-7) is a chemical compound with the molecular formula C10H12ClN3 and a molecular weight of 209.67 g/mol. IUPAC name: 2-(6-chloro-1H-benzimidazol-2-yl)-N-methylethanamine. InChIKey: CVKOOZXYGXPISN-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 2-(6-chloro-1H-benzimidazol-2-yl)-N-methylethanamine |
| InChIKey | CVKOOZXYGXPISN-UHFFFAOYSA-N |
| SMILES | CNCCC1=NC2=C(N1)C=C(C=C2)Cl |
Computed by PubChem (NCBI)