CAS 1269225-01-5 appears in our catalog under these names: [2-(1H-Pyrazol-1-yl)phenyl]methanamine hydrochloride, 95%, (2-(1H-Pyrazol-1-yl)benzyl)amine hydrochloride, (2-(1H-Pyrazol-1-yl)phenyl)methanamine hydrochloride, 95%, 95%, (2-(1H-Pyrazol-1-yl)phenyl)methanamine hydrochloride, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg, 25mg, 50mg.
(2-pyrazol-1-ylphenyl)methanamine;hydrochloride (CAS 1269225-01-5) is a chemical compound with the molecular formula C10H12ClN3 and a molecular weight of 209.67 g/mol. IUPAC name: (2-pyrazol-1-ylphenyl)methanamine;hydrochloride. InChIKey: FTLGABDPYAKHSI-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | (2-pyrazol-1-ylphenyl)methanamine;hydrochloride |
| InChIKey | FTLGABDPYAKHSI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN)N2C=CC=N2.Cl |
Computed by PubChem (NCBI)