Products 1240217-89-3
CAS 1240217-89-3 appears in our catalog under these names: 5-o-Tolyl-2H-pyrazol-3-ylamine hydrochloride, 3-(2-Methylphenyl)-1h-pyrazol-5-amine hydrochloride, 95%. Offered by: Biosynth, Combi-blocks, AmBeed. Available pack sizes: 2,5g, 10g, 5g, 1g.
5-(2-methylphenyl)-1H-pyrazol-3-amine;hydrochloride (CAS 1240217-89-3) is a chemical compound with the molecular formula C10H12ClN3 and a molecular weight of 209.67 g/mol. IUPAC name: 5-(2-methylphenyl)-1H-pyrazol-3-amine;hydrochloride. InChIKey: WAOFHNCHKMNFHV-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 5-(2-methylphenyl)-1H-pyrazol-3-amine;hydrochloride |
| InChIKey | WAOFHNCHKMNFHV-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C2=CC(=NN2)N.Cl |
Computed by PubChem (NCBI)