CAS 1181458-27-4 is the registry number for 1-Benzyl-1h-pyrazol-3-amine hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 250mg, 5g.
1-benzylpyrazol-3-amine;hydrochloride (CAS 1181458-27-4) is a chemical compound with the molecular formula C10H12ClN3 and a molecular weight of 209.67 g/mol. IUPAC name: 1-benzylpyrazol-3-amine;hydrochloride. InChIKey: YTMZIFXCKOHKAE-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 1-benzylpyrazol-3-amine;hydrochloride |
| InChIKey | YTMZIFXCKOHKAE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=CC(=N2)N.Cl |
Computed by PubChem (NCBI)