CAS 1379340-25-6 appears in our catalog under these names: 2-(tert-Butyl)-4-chloro-7h-pyrrolo[2,3-d]pyrimidine, 95%, 2-(tert-Butyl)-4-chloro-7H-pyrrolo(2,3-d)pyrimidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g, 10g.
2-tert-butyl-4-chloro-7H-pyrrolo[2,3-d]pyrimidine (CAS 1379340-25-6) is a chemical compound with the molecular formula C10H12ClN3 and a molecular weight of 209.67 g/mol. IUPAC name: 2-tert-butyl-4-chloro-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: OZTDRUMVTMLRFV-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | 2-tert-butyl-4-chloro-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | OZTDRUMVTMLRFV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=NC2=C(C=CN2)C(=N1)Cl |
Computed by PubChem (NCBI)