CAS 886457-65-4 appears in our catalog under these names: (4–(1H–Imidazol–1–yl)phenyl)methanamine hydrochloride, (4-(1H-Imidazol-1-yl)phenyl)methanamine hydrochloride, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g.
(4-imidazol-1-ylphenyl)methanamine;hydrochloride (CAS 886457-65-4) is a chemical compound with the molecular formula C10H12ClN3 and a molecular weight of 209.67 g/mol. IUPAC name: (4-imidazol-1-ylphenyl)methanamine;hydrochloride. InChIKey: YUVDXSXHWIREGT-UHFFFAOYSA-N.
| Molecular formula | C10H12ClN3 |
|---|---|
| Molecular weight | 209.67 g/mol |
| IUPAC name | (4-imidazol-1-ylphenyl)methanamine;hydrochloride |
| InChIKey | YUVDXSXHWIREGT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN)N2C=CN=C2.Cl |
Computed by PubChem (NCBI)