cas: 1197668-23-7 — see every product listed under this CAS number, including other names
5-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 98%, 98% (CAS 1197668-23-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 500mg, 1g, 5g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111PM4-50mg |
| cas | 1197668-23-7 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 78.80 Pln | |
| Chemat | 500mg | 208.40 Pln | |
| Chemat | 1g | 338.00 Pln | |
| Chemat | 5g | 1374.80 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 136.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1197668-23-7) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: JRYBHXVWIQBARN-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | JRYBHXVWIQBARN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=CC(=C2)Cl.Cl |
Computed by PubChem (NCBI)