cas: 1197668-23-7 — see every product listed under this CAS number, including other names
5-Chloro-2,3-dihydro-1H-inden-1-amine hydrochloride, 98% (CAS 1197668-23-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F224126-100MG |
| cas | 1197668-23-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 372.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 1197668-23-7) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: 5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: JRYBHXVWIQBARN-UHFFFAOYSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | 5-chloro-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | JRYBHXVWIQBARN-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=CC(=C2)Cl.Cl |
Computed by PubChem (NCBI)