5-Chloro-2-methylbenzene-1-sulfonyl chloride 98%
cas: 34981-38-9 — see every product listed under this CAS number, including other names
5-Chloro-2-methylbenzene-1-sulfonyl chloride 98% (CAS 34981-38-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A879355-100mg |
| cas | 34981-38-9 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 854.31 Pln | |
| Ambeed | 10g | 1560.75 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A879355 |
5-chloro-2-methylbenzenesulfonyl chloride (CAS 34981-38-9) is a chemical compound with the molecular formula C7H6Cl2O2S and a molecular weight of 225.09 g/mol. IUPAC name: 5-chloro-2-methylbenzenesulfonyl chloride. InChIKey: VHBFBNCERXCECQ-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2O2S |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 5-chloro-2-methylbenzenesulfonyl chloride |
| InChIKey | VHBFBNCERXCECQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
4-Chlorotoluene-2-sulphonyl chloride, Benzenesulfonyl chloride, 5-chloro-2-methyl-, 5-chloro-2-methylbenzenesulfonyl chloride, 5-Chloro-2-methylbenzene-1-sulfonyl chloride, 2-Chlorosulfonyl-4-chlorotoluene, 5-Chloro-2-Methylbenzenesulfonylchloride, o-Toluenesulfonyl chloride, 5-chloro-, 2-Methyl-5-chlorobenzenesulfonyl chloride, 3-Chloro-6-methylbenzenesulfonyl chloride, 3-chloro-6-methyl-benzenesulfonyl chloride