cas: 25781-92-4 — see every product listed under this CAS number, including other names
5-Chloro-2-nitro-N-phenylaniline 98% (CAS 25781-92-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A666382-1g |
| cas | 25781-92-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 587.31 Pln | |
| Ambeed | 500g | 1994.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A666382 |
5-chloro-2-nitro-N-phenylaniline (CAS 25781-92-4) is a chemical compound with the molecular formula C12H9ClN2O2 and a molecular weight of 248.66 g/mol. IUPAC name: 5-chloro-2-nitro-N-phenylaniline. InChIKey: FPKHZBVGKMTUHB-UHFFFAOYSA-N.
| Molecular formula | C12H9ClN2O2 |
|---|---|
| Molecular weight | 248.66 g/mol |
| IUPAC name | 5-chloro-2-nitro-N-phenylaniline |
| InChIKey | FPKHZBVGKMTUHB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=C(C=CC(=C2)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)