cas: 245325-31-9 — see every product listed under this CAS number, including other names
5-Chloro-3-nitro-1H-pyrazolo(3,4-c)pyridine, 98% (CAS 245325-31-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1234630-5g |
| cas | 245325-31-9 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8526.49 Pln | |
| AmBeed | 10g | 14489.65 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-chloro-3-nitro-2H-pyrazolo[3,4-c]pyridine (CAS 245325-31-9) is a chemical compound with the molecular formula C6H3ClN4O2 and a molecular weight of 198.57 g/mol. IUPAC name: 5-chloro-3-nitro-2H-pyrazolo[3,4-c]pyridine. InChIKey: OSOOLZRMDKKKBX-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN4O2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | 5-chloro-3-nitro-2H-pyrazolo[3,4-c]pyridine |
| InChIKey | OSOOLZRMDKKKBX-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC2=NNC(=C21)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)