cas: 245325-31-9 — see every product listed under this CAS number, including other names
5-Chloro-3-nitro-1H-pyrazolo[3,4-c]pyridine, 98%, 98% (CAS 245325-31-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BJSN-100mg |
| cas | 245325-31-9 |
| size | 100mg |
| availability | 11g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1226.00 Pln | |
| Chemat | 5g | 4888.40 Pln | |
| Chemat | 10g | 7643.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-chloro-3-nitro-2H-pyrazolo[3,4-c]pyridine (CAS 245325-31-9) is a chemical compound with the molecular formula C6H3ClN4O2 and a molecular weight of 198.57 g/mol. IUPAC name: 5-chloro-3-nitro-2H-pyrazolo[3,4-c]pyridine. InChIKey: OSOOLZRMDKKKBX-UHFFFAOYSA-N.
| Molecular formula | C6H3ClN4O2 |
|---|---|
| Molecular weight | 198.57 g/mol |
| IUPAC name | 5-chloro-3-nitro-2H-pyrazolo[3,4-c]pyridine |
| InChIKey | OSOOLZRMDKKKBX-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC2=NNC(=C21)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)