cas: 146328-87-2 — see every product listed under this CAS number, including other names
5-Cyano-2-fluorobenzoic acid, 98% (CAS 146328-87-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092334-250MG |
| cas | 146328-87-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 91.65 Pln | |
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 10g | 258.26 Pln | |
| Fluorochem | 25g | 502.97 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-cyano-2-fluorobenzoic acid (CAS 146328-87-2) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 5-cyano-2-fluorobenzoic acid. InChIKey: UQXVUTYCTZULCD-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 5-cyano-2-fluorobenzoic acid |
| InChIKey | UQXVUTYCTZULCD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)C(=O)O)F |
Computed by PubChem (NCBI)