cas: 94514-21-3 — see every product listed under this CAS number, including other names
5-FLUORO-2,3-DIHYDRO-1H-ISOINDOLE-1,3-DIONE, 98% (CAS 94514-21-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F861402-100MG |
| cas | 94514-21-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 450.90 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 500mg | 997.58 Pln | |
| Fluorochem | 1g | 1158.98 Pln | |
| Fluorochem | 2.5g | 2799.03 Pln | |
| Fluorochem | 5g | 4006.94 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-fluoroisoindole-1,3-dione (CAS 94514-21-3) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 5-fluoroisoindole-1,3-dione. InChIKey: DVDRUQOUGHIYCB-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 5-fluoroisoindole-1,3-dione |
| InChIKey | DVDRUQOUGHIYCB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)NC2=O |
Computed by PubChem (NCBI)