cas: 17112-91-3 — see every product listed under this CAS number, including other names
5-Hydroxy-2-methylnaphtho[1,2-b]furan-3-carboxylic acid 95% (CAS 17112-91-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A521804-100mg |
| cas | 17112-91-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 353.69 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1388.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A521804 |
5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylic acid (CAS 17112-91-3) is a chemical compound with the molecular formula C14H10O4 and a molecular weight of 242.23 g/mol. IUPAC name: 5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylic acid. InChIKey: KWWOZAUJADMVLR-UHFFFAOYSA-N.
| Molecular formula | C14H10O4 |
|---|---|
| Molecular weight | 242.23 g/mol |
| IUPAC name | 5-hydroxy-2-methylbenzo[g][1]benzofuran-3-carboxylic acid |
| InChIKey | KWWOZAUJADMVLR-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(O1)C3=CC=CC=C3C(=C2)O)C(=O)O |
Computed by PubChem (NCBI)