cas: 3952-69-0 — see every product listed under this CAS number, including other names
5-Hydroxy-4H-1-benzopyran-4-one (CAS 3952-69-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F653749-100MG |
| cas | 3952-69-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 768.50 Pln | |
| Fluorochem | 250mg | 1263.11 Pln | |
| Fluorochem | 1g | 3278.03 Pln | |
| Fluorochem | 5g | 13514.01 Pln |
| delivery time | 3-4 weeks |
|---|
5-hydroxychromen-4-one (CAS 3952-69-0) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 5-hydroxychromen-4-one. InChIKey: CJMXMDVAKVSKFI-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 5-hydroxychromen-4-one |
| InChIKey | CJMXMDVAKVSKFI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=O)C=COC2=C1)O |
Computed by PubChem (NCBI)