cas: 3952-69-0 — see every product listed under this CAS number, including other names
5-Hydroxy-4H-chromen-4-one 95% (CAS 3952-69-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A285368-100mg |
| cas | 3952-69-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 437.12 Pln | |
| Ambeed | 250mg | 698.56 Pln | |
| Ambeed | 1g | 1772.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A285368 |
5-hydroxychromen-4-one (CAS 3952-69-0) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 5-hydroxychromen-4-one. InChIKey: CJMXMDVAKVSKFI-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 5-hydroxychromen-4-one |
| InChIKey | CJMXMDVAKVSKFI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=O)C=COC2=C1)O |
Computed by PubChem (NCBI)