cas: 67765-42-8 — see every product listed under this CAS number, including other names
5-Methoxy-1H-benzo[d][1,3]oxazine-2,4-dione, 98% (CAS 67765-42-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g, 250mg, 10g, 25g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QB-0281-5g |
| cas | 67765-42-8 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 976.76 Pln | |
| Fluorochem | 10g | 1372.45 Pln | |
| Fluorochem | 25g | 3345.71 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5-methoxy-1H-3,1-benzoxazine-2,4-dione (CAS 67765-42-8) is a chemical compound with the molecular formula C9H7NO4 and a molecular weight of 193.16 g/mol. IUPAC name: 5-methoxy-1H-3,1-benzoxazine-2,4-dione. InChIKey: KIZGBTDENGRWRS-UHFFFAOYSA-N.
| Molecular formula | C9H7NO4 |
|---|---|
| Molecular weight | 193.16 g/mol |
| IUPAC name | 5-methoxy-1H-3,1-benzoxazine-2,4-dione |
| InChIKey | KIZGBTDENGRWRS-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C1C(=O)OC(=O)N2 |
Computed by PubChem (NCBI)