cas: 1187927-68-9 — see every product listed under this CAS number, including other names
5-Methyl-1H-imidazol-2-amine oxalate, 98%, 98% (CAS 1187927-68-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch119TO8-100mg |
| cas | 1187927-68-9 |
| size | 100mg |
| availability | 0.4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 770.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-methyl-1H-imidazol-2-amine;oxalic acid (CAS 1187927-68-9) is a chemical compound with the molecular formula C6H9N3O4 and a molecular weight of 187.15 g/mol. IUPAC name: 5-methyl-1H-imidazol-2-amine;oxalic acid. InChIKey: MTVXRVZNQWFHAH-UHFFFAOYSA-N.
| Molecular formula | C6H9N3O4 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | 5-methyl-1H-imidazol-2-amine;oxalic acid |
| InChIKey | MTVXRVZNQWFHAH-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(N1)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)