Products 2196180-19-3
CAS 2196180-19-3 appears in our catalog under these names: Metronidazole-hydroxy D2, D2-Metronidazole-hydroxy, Concentration: 100 µg/ml Solvent: Methanol, D2-Metronidazole-hydroxy, Hydroxymetronidazole-d2. Offered by: Dr. Ehrenstorfer, HPC Standards, MedChemExpress. Available pack sizes: 10mg, 1x1ml, 1x10mg, 1 mg.
2-[2-[dideuterio(hydroxy)methyl]-5-nitroimidazol-1-yl]ethanol (CAS 2196180-19-3) is a chemical compound with the molecular formula C6H9N3O4 and a molecular weight of 189.17 g/mol. IUPAC name: 2-[2-[dideuterio(hydroxy)methyl]-5-nitroimidazol-1-yl]ethanol. InChIKey: AEHPOYAOLCAMIU-APZFVMQVSA-N.
| Molecular formula | C6H9N3O4 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 2-[2-[dideuterio(hydroxy)methyl]-5-nitroimidazol-1-yl]ethanol |
| InChIKey | AEHPOYAOLCAMIU-APZFVMQVSA-N |
| SMILES | [2H]C([2H])(C1=NC=C(N1CCO)[N+](=O)[O-])O |
Computed by PubChem (NCBI)