CAS 67546-20-7 is the registry number for 1,6-Anhydro-2-azido-2-deoxy-b-D-glucopyranose. Offered by: Chemat, Biosynth. Available pack sizes: 10g, 1g, 2g, 500mg, 5g, 100mg, 50mg, 250mg.
(1R,2S,3R,4R,5R)-4-azido-6,8-dioxabicyclo[3.2.1]octane-2,3-diol (CAS 67546-20-7) is a chemical compound with the molecular formula C6H9N3O4 and a molecular weight of 187.15 g/mol. IUPAC name: (1R,2S,3R,4R,5R)-4-azido-6,8-dioxabicyclo[3.2.1]octane-2,3-diol. InChIKey: HUGTZKVAMGZNKH-QZABAPFNSA-N.
| Molecular formula | C6H9N3O4 |
|---|---|
| Molecular weight | 187.15 g/mol |
| IUPAC name | (1R,2S,3R,4R,5R)-4-azido-6,8-dioxabicyclo[3.2.1]octane-2,3-diol |
| InChIKey | HUGTZKVAMGZNKH-QZABAPFNSA-N |
| SMILES | C1[C@@H]2[C@H]([C@@H]([C@H]([C@H](O1)O2)N=[N+]=[N-])O)O |
Computed by PubChem (NCBI)