CAS 1215071-08-1 appears in our catalog under these names: Hydroxy Metronidazole-d4, >95% (HPLC), Hydroxymetronidazole-d4. Offered by: TRC, MedChemExpress. Available pack sizes: 10mg, 1mg, 1 mg.
1,1,2,2-tetradeuterio-2-[2-(hydroxymethyl)-5-nitroimidazol-1-yl]ethanol (CAS 1215071-08-1) is a chemical compound with the molecular formula C6H9N3O4 and a molecular weight of 191.18 g/mol. IUPAC name: 1,1,2,2-tetradeuterio-2-[2-(hydroxymethyl)-5-nitroimidazol-1-yl]ethanol. InChIKey: AEHPOYAOLCAMIU-LNLMKGTHSA-N.
| Molecular formula | C6H9N3O4 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 1,1,2,2-tetradeuterio-2-[2-(hydroxymethyl)-5-nitroimidazol-1-yl]ethanol |
| InChIKey | AEHPOYAOLCAMIU-LNLMKGTHSA-N |
| SMILES | [2H]C([2H])(C([2H])([2H])O)N1C(=CN=C1CO)[N+](=O)[O-] |
Computed by PubChem (NCBI)