CAS 1002310-51-1 is the registry number for (6-Phenyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(6-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanamine (CAS 1002310-51-1) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: (6-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanamine. InChIKey: YPHJBEMWJNBPJH-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | (6-phenyl-[1,2,4]triazolo[4,3-b]pyridazin-3-yl)methanamine |
| InChIKey | YPHJBEMWJNBPJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN3C(=NN=C3CN)C=C2 |
Computed by PubChem (NCBI)