CAS 147028-87-3 is the registry number for N3-(Benzyl-D7)-Adenine, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
3-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-7H-purin-6-imine (CAS 147028-87-3) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 232.29 g/mol. IUPAC name: 3-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-7H-purin-6-imine. InChIKey: CZJZYCFVITYHDO-XZJKGWKKSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 232.29 g/mol |
| IUPAC name | 3-[dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methyl]-7H-purin-6-imine |
| InChIKey | CZJZYCFVITYHDO-XZJKGWKKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])N2C=NC(=N)C3=C2N=CN3)[2H])[2H] |
Computed by PubChem (NCBI)