CAS 72966-18-8 is the registry number for 7-Methyl-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-methyl-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (CAS 72966-18-8) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 7-methyl-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine. InChIKey: UYHWZFMNTNPBCN-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 7-methyl-5-phenyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| InChIKey | UYHWZFMNTNPBCN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=NC(=NN12)N)C3=CC=CC=C3 |
Computed by PubChem (NCBI)