CAS 7280-81-1 appears in our catalog under these names: 3-Benzyladenine, min. 95 %, 1 g, 3-Benzyladenine, >95% (HPLC), 3–Benzyladenine, 3-Benzyladenine, 3-BENZYLADENINE, 95%. Offered by: Roth, TRC, GLPBio, Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 10mg, 50mg, 5mg, 500mg, 250mg, 1000mg, 2000mg.
3-benzyl-7H-purin-6-imine (CAS 7280-81-1) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 3-benzyl-7H-purin-6-imine. InChIKey: CZJZYCFVITYHDO-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 3-benzyl-7H-purin-6-imine |
| InChIKey | CZJZYCFVITYHDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C=NC(=N)C3=C2N=CN3 |
Computed by PubChem (NCBI)