Products 1346245-04-2
CAS 1346245-04-2 is the registry number for 3-(1-Methyl-1H-pyrazol-4-yl)quinoxalin-6-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1-methylpyrazol-4-yl)quinoxalin-6-amine (CAS 1346245-04-2) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: 3-(1-methylpyrazol-4-yl)quinoxalin-6-amine. InChIKey: BISOXOHVBZOOFL-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 3-(1-methylpyrazol-4-yl)quinoxalin-6-amine |
| InChIKey | BISOXOHVBZOOFL-UHFFFAOYSA-N |
| SMILES | CN1C=C(C=N1)C2=CN=C3C=CC(=CC3=N2)N |
Computed by PubChem (NCBI)