cas: 88751-06-8 — see every product listed under this CAS number, including other names
5-Methylimidazo[1,2-a]pyridine-2-carboxylic acid 98% (CAS 88751-06-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A262214-250mg |
| cas | 88751-06-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 509.44 Pln | |
| Ambeed | 10g | 943.31 Pln | |
| Ambeed | 25g | 1421.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A262214 |
5-methylimidazo[1,2-a]pyridine-2-carboxylic acid (CAS 88751-06-8) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: 5-methylimidazo[1,2-a]pyridine-2-carboxylic acid. InChIKey: ITABKLPNHAGZEG-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 5-methylimidazo[1,2-a]pyridine-2-carboxylic acid |
| InChIKey | ITABKLPNHAGZEG-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC2=NC(=CN12)C(=O)O |
Computed by PubChem (NCBI)