cas: 1415238-77-5 — see every product listed under this CAS number, including other names
5S rRNA modificator, 95.61% (CAS 1415238-77-5) is a chemical reagent available from Chemat. Available pack sizes: 100 mg, 10 mg, 5 mg, 50 mg, 1 mg, 10mM/1mL. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-18408-100 mg |
| cas | 1415238-77-5 |
| size | 100 mg |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 mg | 3863.06 Pln | |
| MedChemExpress | 10 mg | 886.26 Pln | |
| MedChemExpress | 5 mg | 551.89 Pln | |
| MedChemExpress | 50 mg | 2711.35 Pln | |
| MedChemExpress | 1 mg | 310.40 Pln | |
| MedChemExpress | 10mM/1mL | 593.69 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 95.61% |
Imidazol-1-yl-(2-methylfuran-3-yl)methanone (CAS 1415238-77-5) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: imidazol-1-yl-(2-methylfuran-3-yl)methanone. InChIKey: OOBPIWAAJBRELM-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | imidazol-1-yl-(2-methylfuran-3-yl)methanone |
| InChIKey | OOBPIWAAJBRELM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CO1)C(=O)N2C=CN=C2 |
Computed by PubChem (NCBI)