cas: 1415238-77-5 — see every product listed under this CAS number, including other names
5S rRNA modificator, 98+% (CAS 1415238-77-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A867985-1g |
| cas | 1415238-77-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 12172.09 Pln | |
| AmBeed | 5g | 15023.47 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Imidazol-1-yl-(2-methylfuran-3-yl)methanone (CAS 1415238-77-5) is a chemical compound with the molecular formula C9H8N2O2 and a molecular weight of 176.17 g/mol. IUPAC name: imidazol-1-yl-(2-methylfuran-3-yl)methanone. InChIKey: OOBPIWAAJBRELM-UHFFFAOYSA-N.
| Molecular formula | C9H8N2O2 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | imidazol-1-yl-(2-methylfuran-3-yl)methanone |
| InChIKey | OOBPIWAAJBRELM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CO1)C(=O)N2C=CN=C2 |
Computed by PubChem (NCBI)